C22H22 — CID 173347258
1,1'-biphenyl;tricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 173347258) has the molecular formula C22H22 and a molecular weight of 286.42 g/mol. Its IUPAC name is 1,1'-biphenyl;tricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | 1,1'-biphenyl;tricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 173347258 |
| Molecular Formula | C22H22 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1,1'-biphenyl;tricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | C1=CC2C3C=CC(C3)C2C1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C10H12/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-9-7-4-5-8(6-7)10(9)3-1/h1-10H;1-2,4-5,7-10H,3,6H2 |
| InChIKey | GXUHTDPIEONNKR-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|