C82H104 — CID 173347627
2,4-dihexyl-1-methylbenzene;toluene (PubChem CID 173347627) has the molecular formula C82H104 and a molecular weight of 1089.73 g/mol. Its IUPAC name is 2,4-dihexyl-1-methylbenzene;toluene.
| Compound Name | 2,4-dihexyl-1-methylbenzene;toluene |
|---|---|
| PubChem CID | 173347627 |
| Molecular Formula | C82H104 |
| Molecular Weight | 1089.73 g/mol |
| Exact Mass | 1088.81 |
| IUPAC Name | 2,4-dihexyl-1-methylbenzene;toluene |
| SMILES | CCCCCCc1ccc(C)c(CCCCCC)c1.Cc1ccccc1.Cc1ccccc1.Cc1ccccc1.Cc1ccccc1.Cc1ccccc1.Cc1ccccc1.Cc1ccccc1.Cc1ccccc1.Cc1ccccc1 |
| InChI | InChI=1S/C19H32.9C7H8/c1-4-6-8-10-12-18-15-14-17(3)19(16-18)13-11-9-7-5-2;9*1-7-5-3-2-4-6-7/h14-16H,4-13H2,1-3H3;9*2-6H,1H3 |
| InChIKey | NKAKMGZQSGAQNK-UHFFFAOYSA-N |
| XLogP | 24.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1089.73 |
| LogP ≤ 5 | 24.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|