About 7-chloro-2,4-dioxo-1H-quinazoline-8-carboxamide
7-chloro-2,4-dioxo-1H-quinazoline-8-carboxamide (PubChem CID 173347854) has the molecular formula C9H6ClN3O3
and a molecular weight of 239.62 g/mol. Its IUPAC name is 7-chloro-2,4-dioxo-1H-quinazoline-8-carboxamide.
Molecular Properties
| Compound Name | 7-chloro-2,4-dioxo-1H-quinazoline-8-carboxamide |
| PubChem CID | 173347854 |
| Molecular Formula | C9H6ClN3O3 |
| Molecular Weight | 239.62 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | 7-chloro-2,4-dioxo-1H-quinazoline-8-carboxamide |
| SMILES | NC(=O)c1c(Cl)ccc2c(=O)[nH]c(=O)[nH]c12 |
| InChI | InChI=1S/C9H6ClN3O3/c10-4-2-1-3-6(5(4)7(11)14)12-9(16)13-8(3)15/h1-2H,(H2,11,14)(H2,12,13,15,16) |
| InChIKey | PAQOJKDLHGXCEE-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 108.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.62 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-chloro-2,4-dioxo-1H-quinazoline-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2,4-dioxo-1H-quinazoline-8-carboxamide?
The IUPAC name of 7-chloro-2,4-dioxo-1H-quinazoline-8-carboxamide (CID 173347854) is 7-chloro-2,4-dioxo-1H-quinazoline-8-carboxamide.
What is the SMILES notation for 7-chloro-2,4-dioxo-1H-quinazoline-8-carboxamide?
The canonical SMILES for 7-chloro-2,4-dioxo-1H-quinazoline-8-carboxamide is NC(=O)c1c(Cl)ccc2c(=O)[nH]c(=O)[nH]c12.
What is the InChIKey of 7-chloro-2,4-dioxo-1H-quinazoline-8-carboxamide?
The InChIKey is PAQOJKDLHGXCEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClN3O3/c10-4-2-1-3-6(5(4)7(11)14)12-9(16)13-8(3)15/h1-2H,(H2,11,14)(H2,12,13,15,16).
What are the key properties of 7-chloro-2,4-dioxo-1H-quinazoline-8-carboxamide?
7-chloro-2,4-dioxo-1H-quinazoline-8-carboxamide has a molecular weight of 239.62 g/mol, XLogP of -0.03, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2,4-dioxo-1H-quinazoline-8-carboxamide is sourced from PubChem (CID 173347854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).