C16H18F3N3O3 — CID 173347889
10-amino-7-methyl-2-prop-2-enyl-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,9-trien-11-one;2,2,2-trifluoroacetic acid (PubChem CID 173347889) has the molecular formula C16H18F3N3O3 and a molecular weight of 357.33 g/mol. Its IUPAC name is 10-amino-7-methyl-2-prop-2-enyl-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,9-trien-11-one;2,2,2-trifluoroacetic acid.
| Compound Name | 10-amino-7-methyl-2-prop-2-enyl-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,9-trien-11-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 173347889 |
| Molecular Formula | C16H18F3N3O3 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 10-amino-7-methyl-2-prop-2-enyl-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,9-trien-11-one;2,2,2-trifluoroacetic acid |
| SMILES | C=CCn1cc2c3c1C(=O)C(N)=CC3N(C)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H17N3O.C2HF3O2/c1-3-5-17-8-9-4-6-16(2)11-7-10(15)14(18)13(17)12(9)11;3-2(4,5)1(6)7/h3,7-8,11H,1,4-6,15H2,2H3;(H,6,7) |
| InChIKey | GQRRKOGTLIVHJM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 88.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|