C27H24F3N3O3 — CID 173348233
7-benzyl-10-(benzylamino)-2-methyl-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,9-tetraen-11-one;2,2,2-trifluoroacetic acid (PubChem CID 173348233) has the molecular formula C27H24F3N3O3 and a molecular weight of 495.50 g/mol. Its IUPAC name is 7-benzyl-10-(benzylamino)-2-methyl-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,9-tetraen-11-one;2,2,2-trifluoroacetic acid.
| Compound Name | 7-benzyl-10-(benzylamino)-2-methyl-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,9-tetraen-11-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 173348233 |
| Molecular Formula | C27H24F3N3O3 |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 7-benzyl-10-(benzylamino)-2-methyl-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,9-tetraen-11-one;2,2,2-trifluoroacetic acid |
| SMILES | Cn1cc2c3c1C(=O)C(NCc1ccccc1)=CC3N(Cc1ccccc1)C=C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H23N3O.C2HF3O2/c1-27-17-20-12-13-28(16-19-10-6-3-7-11-19)22-14-21(25(29)24(27)23(20)22)26-15-18-8-4-2-5-9-18;3-2(4,5)1(6)7/h2-14,17,22,26H,15-16H2,1H3;(H,6,7) |
| InChIKey | JXFSREPGUZTQGZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |