C9H12S — CID 173348425
5-propylcyclohexa-2,4-diene-1-thione (PubChem CID 173348425) has the molecular formula C9H12S and a molecular weight of 152.26 g/mol. Its IUPAC name is 5-propylcyclohexa-2,4-diene-1-thione.
| Compound Name | 5-propylcyclohexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 173348425 |
| Molecular Formula | C9H12S |
| Molecular Weight | 152.26 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 5-propylcyclohexa-2,4-diene-1-thione |
| SMILES | CCCC1=CC=CC(=S)C1 |
| InChI | InChI=1S/C9H12S/c1-2-4-8-5-3-6-9(10)7-8/h3,5-6H,2,4,7H2,1H3 |
| InChIKey | JDLRRTAIGCZRTF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|