About 5-methoxy-3H-1,3-azastibole
5-methoxy-3H-1,3-azastibole (PubChem CID 173348534) has the molecular formula C4H6NOSb
and a molecular weight of 205.86 g/mol. Its IUPAC name is 5-methoxy-3H-1,3-azastibole.
Molecular Properties
| Compound Name | 5-methoxy-3H-1,3-azastibole |
| PubChem CID | 173348534 |
| Molecular Formula | C4H6NOSb |
| Molecular Weight | 205.86 g/mol |
| Exact Mass | 204.95 |
| IUPAC Name | 5-methoxy-3H-1,3-azastibole |
| SMILES | COC1=C[SbH]C=N1 |
| InChI | InChI=1S/C4H5NO.Sb.H/c1-4(5-2)6-3;;/h1-2H,3H3;; |
| InChIKey | JGHVALSGCBHRFG-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.86 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-3H-1,3-azastibole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-3H-1,3-azastibole?
The IUPAC name of 5-methoxy-3H-1,3-azastibole (CID 173348534) is 5-methoxy-3H-1,3-azastibole.
What is the SMILES notation for 5-methoxy-3H-1,3-azastibole?
The canonical SMILES for 5-methoxy-3H-1,3-azastibole is COC1=C[SbH]C=N1.
What is the InChIKey of 5-methoxy-3H-1,3-azastibole?
The InChIKey is JGHVALSGCBHRFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO.Sb.H/c1-4(5-2)6-3;;/h1-2H,3H3;;.
What are the key properties of 5-methoxy-3H-1,3-azastibole?
5-methoxy-3H-1,3-azastibole has a molecular weight of 205.86 g/mol, XLogP of -0.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-3H-1,3-azastibole is sourced from PubChem (CID 173348534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).