C19H21N3 — CID 173348604
1-phenyl-N-(2,3,5,6-tetramethylphenyl)pyrazol-3-amine (PubChem CID 173348604) has the molecular formula C19H21N3 and a molecular weight of 291.40 g/mol. Its IUPAC name is 1-phenyl-N-(2,3,5,6-tetramethylphenyl)pyrazol-3-amine.
| Compound Name | 1-phenyl-N-(2,3,5,6-tetramethylphenyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 173348604 |
| Molecular Formula | C19H21N3 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 1-phenyl-N-(2,3,5,6-tetramethylphenyl)pyrazol-3-amine |
| SMILES | Cc1cc(C)c(C)c(Nc2ccn(-c3ccccc3)n2)c1C |
| InChI | InChI=1S/C19H21N3/c1-13-12-14(2)16(4)19(15(13)3)20-18-10-11-22(21-18)17-8-6-5-7-9-17/h5-12H,1-4H3,(H,20,21) |
| InChIKey | NNHUKOYPHAXDOO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |