C18H28BrN7O2 — CID 173348927
2-piperidin-1-ylguanidine;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione;hydrobromide (PubChem CID 173348927) has the molecular formula C18H28BrN7O2 and a molecular weight of 454.37 g/mol. Its IUPAC name is 2-piperidin-1-ylguanidine;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione;hydrobromide.
| Compound Name | 2-piperidin-1-ylguanidine;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione;hydrobromide |
|---|---|
| PubChem CID | 173348927 |
| Molecular Formula | C18H28BrN7O2 |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 2-piperidin-1-ylguanidine;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione;hydrobromide |
| SMILES | Br.NC(N)=NN1CCCCC1.O=C1C=C(N2CC2)C(=O)C(N2CC2)=C1N1CC1 |
| InChI | InChI=1S/C12H13N3O2.C6H14N4.BrH/c16-9-7-8(13-1-2-13)12(17)11(15-5-6-15)10(9)14-3-4-14;7-6(8)9-10-4-2-1-3-5-10;/h7H,1-6H2;1-5H2,(H4,7,8,9);1H |
| InChIKey | DZWJJZPRRNGOMV-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 110.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|