About (5S)-5-[(2R)-1-cyclohexyl-4-methyl-1-oxopentan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-one
(5S)-5-[(2R)-1-cyclohexyl-4-methyl-1-oxopentan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-one (PubChem CID 173349013) has the molecular formula C17H28O4
and a molecular weight of 296.41 g/mol. Its IUPAC name is (5S)-5-[(2R)-1-cyclohexyl-4-methyl-1-oxopentan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-one.
Molecular Properties
| Compound Name | (5S)-5-[(2R)-1-cyclohexyl-4-methyl-1-oxopentan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-one |
| PubChem CID | 173349013 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (5S)-5-[(2R)-1-cyclohexyl-4-methyl-1-oxopentan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-one |
| SMILES | CC(C)C[C@@H](C(=O)C1CCCCC1)[C@@H]1OC(C)(C)OC1=O |
| InChI | InChI=1S/C17H28O4/c1-11(2)10-13(14(18)12-8-6-5-7-9-12)15-16(19)21-17(3,4)20-15/h11-13,15H,5-10H2,1-4H3/t13-,15-/m0/s1 |
| InChIKey | VEUNNMVMROQGNO-ZFWWWQNUSA-N |
| XLogP | 3.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5S)-5-[(2R)-1-cyclohexyl-4-methyl-1-oxopentan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-[(2R)-1-cyclohexyl-4-methyl-1-oxopentan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-one?
The IUPAC name of (5S)-5-[(2R)-1-cyclohexyl-4-methyl-1-oxopentan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-one (CID 173349013) is (5S)-5-[(2R)-1-cyclohexyl-4-methyl-1-oxopentan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-one.
What is the SMILES notation for (5S)-5-[(2R)-1-cyclohexyl-4-methyl-1-oxopentan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-one?
The canonical SMILES for (5S)-5-[(2R)-1-cyclohexyl-4-methyl-1-oxopentan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-one is CC(C)C[C@@H](C(=O)C1CCCCC1)[C@@H]1OC(C)(C)OC1=O.
What is the InChIKey of (5S)-5-[(2R)-1-cyclohexyl-4-methyl-1-oxopentan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-one?
The InChIKey is VEUNNMVMROQGNO-ZFWWWQNUSA-N. The full InChI is InChI=1S/C17H28O4/c1-11(2)10-13(14(18)12-8-6-5-7-9-12)15-16(19)21-17(3,4)20-15/h11-13,15H,5-10H2,1-4H3/t13-,15-/m0/s1.
What are the key properties of (5S)-5-[(2R)-1-cyclohexyl-4-methyl-1-oxopentan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-one?
(5S)-5-[(2R)-1-cyclohexyl-4-methyl-1-oxopentan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-one has a molecular weight of 296.41 g/mol, XLogP of 3.48, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-[(2R)-1-cyclohexyl-4-methyl-1-oxopentan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-one is sourced from PubChem (CID 173349013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).