C2H3LiN2S3 — CID 173349037
lithium;hydride;1,3,4-thiadiazolidine-2,5-dithione (PubChem CID 173349037) has the molecular formula C2H3LiN2S3 and a molecular weight of 158.20 g/mol. Its IUPAC name is lithium;hydride;1,3,4-thiadiazolidine-2,5-dithione.
| Compound Name | lithium;hydride;1,3,4-thiadiazolidine-2,5-dithione |
|---|---|
| PubChem CID | 173349037 |
| Molecular Formula | C2H3LiN2S3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 157.96 |
| IUPAC Name | lithium;hydride;1,3,4-thiadiazolidine-2,5-dithione |
| SMILES | S=c1[nH][nH]c(=S)s1.[H-].[Li+] |
| InChI | InChI=1S/C2H2N2S3.Li.H/c5-1-3-4-2(6)7-1;;/h(H,3,5)(H,4,6);;/q;+1;-1 |
| InChIKey | DUWFXTVTVHAMPG-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|