C9H6ClF3N2O3 — CID 17334923
N-(5-chloro-2-methyl-4-nitrophenyl)-2,2,2-trifluoroacetamide (PubChem CID 17334923) has the molecular formula C9H6ClF3N2O3 and a molecular weight of 282.61 g/mol. Its IUPAC name is N-(5-chloro-2-methyl-4-nitrophenyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(5-chloro-2-methyl-4-nitrophenyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 17334923 |
| Molecular Formula | C9H6ClF3N2O3 |
| Molecular Weight | 282.61 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | N-(5-chloro-2-methyl-4-nitrophenyl)-2,2,2-trifluoroacetamide |
| SMILES | Cc1cc([N+](=O)[O-])c(Cl)cc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H6ClF3N2O3/c1-4-2-7(15(17)18)5(10)3-6(4)14-8(16)9(11,12)13/h2-3H,1H3,(H,14,16) |
| InChIKey | NAEHPFAZYLCMBU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.61 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|