C13H20FN3 — CID 173349535
1-[(5Z,7E)-5-ethenyl-8-fluoronona-5,7-dien-2-ylidene]-2-methylguanidine (PubChem CID 173349535) has the molecular formula C13H20FN3 and a molecular weight of 237.32 g/mol. Its IUPAC name is 1-[(5Z,7E)-5-ethenyl-8-fluoronona-5,7-dien-2-ylidene]-2-methylguanidine.
| Compound Name | 1-[(5Z,7E)-5-ethenyl-8-fluoronona-5,7-dien-2-ylidene]-2-methylguanidine |
|---|---|
| PubChem CID | 173349535 |
| Molecular Formula | C13H20FN3 |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 1-[(5Z,7E)-5-ethenyl-8-fluoronona-5,7-dien-2-ylidene]-2-methylguanidine |
| SMILES | C=C/C(=C\C=C(/C)F)CCC(C)=N/C(N)=N/C |
| InChI | InChI=1S/C13H20FN3/c1-5-12(8-6-10(2)14)9-7-11(3)17-13(15)16-4/h5-6,8H,1,7,9H2,2-4H3,(H2,15,16)/b10-6+,12-8+,17-11? |
| InChIKey | PQKYXUUUZZUQIA-IWKCPLOCSA-N |
| XLogP | 3.16 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|