C35H70O3Si3 — CID 173350145
[(3aS,4S,5R,6aS)-5-tert-butyl-4-[(3S)-3-tert-butyl-8-dimethylsilyloxyoct-1-enyl]-6a-dimethylsilyloxy-2-methylidene-1,3,3a,4,5,6-hexahydropentalen-1-yl]oxy-triethylsilane (PubChem CID 173350145) has the molecular formula C35H70O3Si3 and a molecular weight of 623.20 g/mol. Its IUPAC name is [(3aS,4S,5R,6aS)-5-tert-butyl-4-[(3S)-3-tert-butyl-8-dimethylsilyloxyoct-1-enyl]-6a-dimethylsilyloxy-2-methylidene-1,3,3a,4,5,6-hexahydropentalen-1-yl]oxy-triethylsilane.
| Compound Name | [(3aS,4S,5R,6aS)-5-tert-butyl-4-[(3S)-3-tert-butyl-8-dimethylsilyloxyoct-1-enyl]-6a-dimethylsilyloxy-2-methylidene-1,3,3a,4,5,6-hexahydropentalen-1-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 173350145 |
| Molecular Formula | C35H70O3Si3 |
| Molecular Weight | 623.20 g/mol |
| Exact Mass | 622.46 |
| IUPAC Name | [(3aS,4S,5R,6aS)-5-tert-butyl-4-[(3S)-3-tert-butyl-8-dimethylsilyloxyoct-1-enyl]-6a-dimethylsilyloxy-2-methylidene-1,3,3a,4,5,6-hexahydropentalen-1-yl]oxy-triethylsilane |
| SMILES | C=C1C[C@H]2[C@@H](C=C[C@H](CCCCCO[SiH](C)C)C(C)(C)C)[C@H](C(C)(C)C)C[C@@]2(O[SiH](C)C)C1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C35H70O3Si3/c1-15-41(16-2,17-3)37-32-27(4)25-30-29(31(34(8,9)10)26-35(30,32)38-40(13)14)23-22-28(33(5,6)7)21-19-18-20-24-36-39(11)12/h22-23,28-32,39-40H,4,15-21,24-26H2,1-3,5-14H3/t28-,29+,30-,31+,32?,35-/m0/s1 |
| InChIKey | VIIXHDQEUSZOPF-ZTRKCHHDSA-N |
| XLogP | 10.15 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.20 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|