About (1-cyclohexa-1,5-dien-1-ylpyrrolidin-2-yl)methanol
(1-cyclohexa-1,5-dien-1-ylpyrrolidin-2-yl)methanol (PubChem CID 173351198) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is (1-cyclohexa-1,5-dien-1-ylpyrrolidin-2-yl)methanol.
Molecular Properties
| Compound Name | (1-cyclohexa-1,5-dien-1-ylpyrrolidin-2-yl)methanol |
| PubChem CID | 173351198 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (1-cyclohexa-1,5-dien-1-ylpyrrolidin-2-yl)methanol |
| SMILES | OCC1CCCN1C1=CCCC=C1 |
| InChI | InChI=1S/C11H17NO/c13-9-11-7-4-8-12(11)10-5-2-1-3-6-10/h2,5-6,11,13H,1,3-4,7-9H2 |
| InChIKey | PKUBDZJUAMMICV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-cyclohexa-1,5-dien-1-ylpyrrolidin-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyclohexa-1,5-dien-1-ylpyrrolidin-2-yl)methanol?
The IUPAC name of (1-cyclohexa-1,5-dien-1-ylpyrrolidin-2-yl)methanol (CID 173351198) is (1-cyclohexa-1,5-dien-1-ylpyrrolidin-2-yl)methanol.
What is the SMILES notation for (1-cyclohexa-1,5-dien-1-ylpyrrolidin-2-yl)methanol?
The canonical SMILES for (1-cyclohexa-1,5-dien-1-ylpyrrolidin-2-yl)methanol is OCC1CCCN1C1=CCCC=C1.
What is the InChIKey of (1-cyclohexa-1,5-dien-1-ylpyrrolidin-2-yl)methanol?
The InChIKey is PKUBDZJUAMMICV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c13-9-11-7-4-8-12(11)10-5-2-1-3-6-10/h2,5-6,11,13H,1,3-4,7-9H2.
What are the key properties of (1-cyclohexa-1,5-dien-1-ylpyrrolidin-2-yl)methanol?
(1-cyclohexa-1,5-dien-1-ylpyrrolidin-2-yl)methanol has a molecular weight of 179.26 g/mol, XLogP of 1.68, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyclohexa-1,5-dien-1-ylpyrrolidin-2-yl)methanol is sourced from PubChem (CID 173351198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).