About magnesium;hydroxysilane;1,2,3-trimethylbenzene-6-ide
magnesium;hydroxysilane;1,2,3-trimethylbenzene-6-ide (PubChem CID 173351353) has the molecular formula C9H15MgOSi+
and a molecular weight of 191.61 g/mol. Its IUPAC name is magnesium;hydroxysilane;1,2,3-trimethylbenzene-6-ide.
Molecular Properties
| Compound Name | magnesium;hydroxysilane;1,2,3-trimethylbenzene-6-ide |
| PubChem CID | 173351353 |
| Molecular Formula | C9H15MgOSi+ |
| Molecular Weight | 191.61 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | magnesium;hydroxysilane;1,2,3-trimethylbenzene-6-ide |
| SMILES | Cc1[c-]ccc(C)c1C.O[SiH3].[Mg+2] |
| InChI | InChI=1S/C9H11.Mg.H4OSi/c1-7-5-4-6-8(2)9(7)3;;1-2/h4-5H,1-3H3;;1H,2H3/q-1;+2; |
| InChIKey | WEYGSHWVBPCZOU-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.61 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze magnesium;hydroxysilane;1,2,3-trimethylbenzene-6-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;hydroxysilane;1,2,3-trimethylbenzene-6-ide?
The IUPAC name of magnesium;hydroxysilane;1,2,3-trimethylbenzene-6-ide (CID 173351353) is magnesium;hydroxysilane;1,2,3-trimethylbenzene-6-ide.
What is the SMILES notation for magnesium;hydroxysilane;1,2,3-trimethylbenzene-6-ide?
The canonical SMILES for magnesium;hydroxysilane;1,2,3-trimethylbenzene-6-ide is Cc1[c-]ccc(C)c1C.O[SiH3].[Mg+2].
What is the InChIKey of magnesium;hydroxysilane;1,2,3-trimethylbenzene-6-ide?
The InChIKey is WEYGSHWVBPCZOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11.Mg.H4OSi/c1-7-5-4-6-8(2)9(7)3;;1-2/h4-5H,1-3H3;;1H,2H3/q-1;+2;.
What are the key properties of magnesium;hydroxysilane;1,2,3-trimethylbenzene-6-ide?
magnesium;hydroxysilane;1,2,3-trimethylbenzene-6-ide has a molecular weight of 191.61 g/mol, XLogP of 0.29, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;hydroxysilane;1,2,3-trimethylbenzene-6-ide is sourced from PubChem (CID 173351353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).