C35H58F4N8O — CID 173351591
5-(2,2,3,3-tetrafluoropropoxy)-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane (PubChem CID 173351591) has the molecular formula C35H58F4N8O and a molecular weight of 682.90 g/mol. Its IUPAC name is 5-(2,2,3,3-tetrafluoropropoxy)-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane.
| Compound Name | 5-(2,2,3,3-tetrafluoropropoxy)-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
|---|---|
| PubChem CID | 173351591 |
| Molecular Formula | C35H58F4N8O |
| Molecular Weight | 682.90 g/mol |
| Exact Mass | 682.47 |
| IUPAC Name | 5-(2,2,3,3-tetrafluoropropoxy)-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
| SMILES | FC(F)C(F)(F)COC1CCCC2C3NC4NC(NC5NC(NC6NC(NC(N3)C12)C1CCCCC61)C1CCCCC51)C1CCCCC41 |
| InChI | InChI=1S/C35H58F4N8O/c36-34(37)35(38,39)16-48-24-15-7-14-23-25(24)33-46-31-22-13-6-5-12-21(22)29(44-31)42-27-18-9-2-1-8-17(18)26(40-27)41-28-19-10-3-4-11-20(19)30(43-28)45-32(23)47-33/h17-34,40-47H,1-16H2 |
| InChIKey | DSOHTSKINIAOPE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.90 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|