C21H33N2+ — CID 173352351
dimethyl-[2-[1-methyl-3,3-bis(2-methylpropyl)indol-2-ylidene]ethylidene]azanium (PubChem CID 173352351) has the molecular formula C21H33N2+ and a molecular weight of 313.51 g/mol. Its IUPAC name is dimethyl-[2-[1-methyl-3,3-bis(2-methylpropyl)indol-2-ylidene]ethylidene]azanium.
| Compound Name | dimethyl-[2-[1-methyl-3,3-bis(2-methylpropyl)indol-2-ylidene]ethylidene]azanium |
|---|---|
| PubChem CID | 173352351 |
| Molecular Formula | C21H33N2+ |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.26 |
| IUPAC Name | dimethyl-[2-[1-methyl-3,3-bis(2-methylpropyl)indol-2-ylidene]ethylidene]azanium |
| SMILES | CC(C)CC1(CC(C)C)C(=CC=[N+](C)C)N(C)c2ccccc21 |
| InChI | InChI=1S/C21H33N2/c1-16(2)14-21(15-17(3)4)18-10-8-9-11-19(18)23(7)20(21)12-13-22(5)6/h8-13,16-17H,14-15H2,1-7H3/q+1 |
| InChIKey | ZZEDBPABXPIVMY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|