C17H28O2 — CID 173352389
(2R,4R,5S)-2-deca-2,4,6-trien-2-yl-4-methoxy-5-methyloxane (PubChem CID 173352389) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is (2R,4R,5S)-2-deca-2,4,6-trien-2-yl-4-methoxy-5-methyloxane.
| Compound Name | (2R,4R,5S)-2-deca-2,4,6-trien-2-yl-4-methoxy-5-methyloxane |
|---|---|
| PubChem CID | 173352389 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | (2R,4R,5S)-2-deca-2,4,6-trien-2-yl-4-methoxy-5-methyloxane |
| SMILES | CCCC=CC=CC=C(C)[C@H]1C[C@@H](OC)[C@@H](C)CO1 |
| InChI | InChI=1S/C17H28O2/c1-5-6-7-8-9-10-11-14(2)17-12-16(18-4)15(3)13-19-17/h7-11,15-17H,5-6,12-13H2,1-4H3/t15-,16+,17+/m0/s1 |
| InChIKey | NKOCRHYYHGHDCF-GVDBMIGSSA-N |
| XLogP | 4.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|