C23H27FNNaO5S — CID 173352485
sodium;(Z)-6-[(2S,3R)-1-(4-fluorophenyl)sulfonyl-2-(3-methoxyphenyl)pyrrolidin-3-yl]hex-4-enoic acid;hydride (PubChem CID 173352485) has the molecular formula C23H27FNNaO5S and a molecular weight of 471.53 g/mol. Its IUPAC name is sodium;(Z)-6-[(2S,3R)-1-(4-fluorophenyl)sulfonyl-2-(3-methoxyphenyl)pyrrolidin-3-yl]hex-4-enoic acid;hydride.
| Compound Name | sodium;(Z)-6-[(2S,3R)-1-(4-fluorophenyl)sulfonyl-2-(3-methoxyphenyl)pyrrolidin-3-yl]hex-4-enoic acid;hydride |
|---|---|
| PubChem CID | 173352485 |
| Molecular Formula | C23H27FNNaO5S |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | sodium;(Z)-6-[(2S,3R)-1-(4-fluorophenyl)sulfonyl-2-(3-methoxyphenyl)pyrrolidin-3-yl]hex-4-enoic acid;hydride |
| SMILES | COc1cccc([C@@H]2[C@H](C/C=C\CCC(=O)O)CCN2S(=O)(=O)c2ccc(F)cc2)c1.[H-].[Na+] |
| InChI | InChI=1S/C23H26FNO5S.Na.H/c1-30-20-8-5-7-18(16-20)23-17(6-3-2-4-9-22(26)27)14-15-25(23)31(28,29)21-12-10-19(24)11-13-21;;/h2-3,5,7-8,10-13,16-17,23H,4,6,9,14-15H2,1H3,(H,26,27);;/q;+1;-1/b3-2-;;/t17-,23+;;/m1../s1 |
| InChIKey | NBYWYFNKSOMYBW-BLMNYMKCSA-N |
| XLogP | 1.51 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|