About 5-methoxy-2,3-diphenyl-1H-tetrazole;hydrochloride
5-methoxy-2,3-diphenyl-1H-tetrazole;hydrochloride (PubChem CID 173352497) has the molecular formula C14H15ClN4O
and a molecular weight of 290.75 g/mol. Its IUPAC name is 5-methoxy-2,3-diphenyl-1H-tetrazole;hydrochloride.
Molecular Properties
| Compound Name | 5-methoxy-2,3-diphenyl-1H-tetrazole;hydrochloride |
| PubChem CID | 173352497 |
| Molecular Formula | C14H15ClN4O |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 5-methoxy-2,3-diphenyl-1H-tetrazole;hydrochloride |
| SMILES | COC1=NN(c2ccccc2)N(c2ccccc2)N1.Cl |
| InChI | InChI=1S/C14H14N4O.ClH/c1-19-14-15-17(12-8-4-2-5-9-12)18(16-14)13-10-6-3-7-11-13;/h2-11H,1H3,(H,15,16);1H |
| InChIKey | DEEDTUMBGGNYIG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methoxy-2,3-diphenyl-1H-tetrazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2,3-diphenyl-1H-tetrazole;hydrochloride?
The IUPAC name of 5-methoxy-2,3-diphenyl-1H-tetrazole;hydrochloride (CID 173352497) is 5-methoxy-2,3-diphenyl-1H-tetrazole;hydrochloride.
What is the SMILES notation for 5-methoxy-2,3-diphenyl-1H-tetrazole;hydrochloride?
The canonical SMILES for 5-methoxy-2,3-diphenyl-1H-tetrazole;hydrochloride is COC1=NN(c2ccccc2)N(c2ccccc2)N1.Cl.
What is the InChIKey of 5-methoxy-2,3-diphenyl-1H-tetrazole;hydrochloride?
The InChIKey is DEEDTUMBGGNYIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O.ClH/c1-19-14-15-17(12-8-4-2-5-9-12)18(16-14)13-10-6-3-7-11-13;/h2-11H,1H3,(H,15,16);1H.
What are the key properties of 5-methoxy-2,3-diphenyl-1H-tetrazole;hydrochloride?
5-methoxy-2,3-diphenyl-1H-tetrazole;hydrochloride has a molecular weight of 290.75 g/mol, XLogP of 2.77, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2,3-diphenyl-1H-tetrazole;hydrochloride is sourced from PubChem (CID 173352497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).