C24H30 — CID 173352639
(8R,9S,10S,13S,14S)-13-methyl-1-phenyl-1,2,3,4,7,8,9,10,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene (PubChem CID 173352639) has the molecular formula C24H30 and a molecular weight of 318.50 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S)-13-methyl-1-phenyl-1,2,3,4,7,8,9,10,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene.
| Compound Name | (8R,9S,10S,13S,14S)-13-methyl-1-phenyl-1,2,3,4,7,8,9,10,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 173352639 |
| Molecular Formula | C24H30 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | (8R,9S,10S,13S,14S)-13-methyl-1-phenyl-1,2,3,4,7,8,9,10,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
| SMILES | C[C@]12C=C[C@H]3[C@@H](CC=C4CCCC(c5ccccc5)[C@@H]43)[C@@H]1CCC2 |
| InChI | InChI=1S/C24H30/c1-24-15-6-11-22(24)20-13-12-18-9-5-10-19(17-7-3-2-4-8-17)23(18)21(20)14-16-24/h2-4,7-8,12,14,16,19-23H,5-6,9-11,13,15H2,1H3/t19?,20-,21+,22+,23-,24+/m1/s1 |
| InChIKey | YQLXILZYKQYLSH-AZNBXHQOSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|