About morpholine;4-phenylpiperidin-2-one
morpholine;4-phenylpiperidin-2-one (PubChem CID 173352656) has the molecular formula C15H22N2O2
and a molecular weight of 262.35 g/mol. Its IUPAC name is morpholine;4-phenylpiperidin-2-one.
Molecular Properties
| Compound Name | morpholine;4-phenylpiperidin-2-one |
| PubChem CID | 173352656 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | morpholine;4-phenylpiperidin-2-one |
| SMILES | C1COCCN1.O=C1CC(c2ccccc2)CCN1 |
| InChI | InChI=1S/C11H13NO.C4H9NO/c13-11-8-10(6-7-12-11)9-4-2-1-3-5-9;1-3-6-4-2-5-1/h1-5,10H,6-8H2,(H,12,13);5H,1-4H2 |
| InChIKey | SYPKKMDTPWOSQT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze morpholine;4-phenylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholine;4-phenylpiperidin-2-one?
The IUPAC name of morpholine;4-phenylpiperidin-2-one (CID 173352656) is morpholine;4-phenylpiperidin-2-one.
What is the SMILES notation for morpholine;4-phenylpiperidin-2-one?
The canonical SMILES for morpholine;4-phenylpiperidin-2-one is C1COCCN1.O=C1CC(c2ccccc2)CCN1.
What is the InChIKey of morpholine;4-phenylpiperidin-2-one?
The InChIKey is SYPKKMDTPWOSQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO.C4H9NO/c13-11-8-10(6-7-12-11)9-4-2-1-3-5-9;1-3-6-4-2-5-1/h1-5,10H,6-8H2,(H,12,13);5H,1-4H2.
What are the key properties of morpholine;4-phenylpiperidin-2-one?
morpholine;4-phenylpiperidin-2-one has a molecular weight of 262.35 g/mol, XLogP of 1.29, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine;4-phenylpiperidin-2-one is sourced from PubChem (CID 173352656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).