About 3-hydroxy-1H-pyridin-4-one;indigane
3-hydroxy-1H-pyridin-4-one;indigane (PubChem CID 173352828) has the molecular formula C5H8InNO2
and a molecular weight of 228.94 g/mol. Its IUPAC name is 3-hydroxy-1H-pyridin-4-one;indigane.
Molecular Properties
| Compound Name | 3-hydroxy-1H-pyridin-4-one;indigane |
| PubChem CID | 173352828 |
| Molecular Formula | C5H8InNO2 |
| Molecular Weight | 228.94 g/mol |
| Exact Mass | 228.96 |
| IUPAC Name | 3-hydroxy-1H-pyridin-4-one;indigane |
| SMILES | O=c1cc[nH]cc1O.[InH3] |
| InChI | InChI=1S/C5H5NO2.In.3H/c7-4-1-2-6-3-5(4)8;;;;/h1-3,8H,(H,6,7);;;; |
| InChIKey | FRPJPBSECIYZJK-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.94 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-hydroxy-1H-pyridin-4-one;indigane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-1H-pyridin-4-one;indigane?
The IUPAC name of 3-hydroxy-1H-pyridin-4-one;indigane (CID 173352828) is 3-hydroxy-1H-pyridin-4-one;indigane.
What is the SMILES notation for 3-hydroxy-1H-pyridin-4-one;indigane?
The canonical SMILES for 3-hydroxy-1H-pyridin-4-one;indigane is O=c1cc[nH]cc1O.[InH3].
What is the InChIKey of 3-hydroxy-1H-pyridin-4-one;indigane?
The InChIKey is FRPJPBSECIYZJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO2.In.3H/c7-4-1-2-6-3-5(4)8;;;;/h1-3,8H,(H,6,7);;;;.
What are the key properties of 3-hydroxy-1H-pyridin-4-one;indigane?
3-hydroxy-1H-pyridin-4-one;indigane has a molecular weight of 228.94 g/mol, XLogP of -1.10, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-1H-pyridin-4-one;indigane is sourced from PubChem (CID 173352828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).