About (2S)-2-[bis(2,6-ditert-butyl-4-methylphenoxy)amino]propanal
(2S)-2-[bis(2,6-ditert-butyl-4-methylphenoxy)amino]propanal (PubChem CID 173353632) has the molecular formula C33H51NO3
and a molecular weight of 509.78 g/mol. Its IUPAC name is (2S)-2-[bis(2,6-ditert-butyl-4-methylphenoxy)amino]propanal.
Molecular Properties
| Compound Name | (2S)-2-[bis(2,6-ditert-butyl-4-methylphenoxy)amino]propanal |
| PubChem CID | 173353632 |
| Molecular Formula | C33H51NO3 |
| Molecular Weight | 509.78 g/mol |
| Exact Mass | 509.39 |
| IUPAC Name | (2S)-2-[bis(2,6-ditert-butyl-4-methylphenoxy)amino]propanal |
| SMILES | Cc1cc(C(C)(C)C)c(ON(Oc2c(C(C)(C)C)cc(C)cc2C(C)(C)C)[C@@H](C)C=O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H51NO3/c1-21-16-24(30(4,5)6)28(25(17-21)31(7,8)9)36-34(23(3)20-35)37-29-26(32(10,11)12)18-22(2)19-27(29)33(13,14)15/h16-20,23H,1-15H3/t23-/m0/s1 |
| InChIKey | LFCLHYLCTFYTQP-QHCPKHFHSA-N |
| XLogP | 8.67 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 509.78 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[bis(2,6-ditert-butyl-4-methylphenoxy)amino]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[bis(2,6-ditert-butyl-4-methylphenoxy)amino]propanal?
The IUPAC name of (2S)-2-[bis(2,6-ditert-butyl-4-methylphenoxy)amino]propanal (CID 173353632) is (2S)-2-[bis(2,6-ditert-butyl-4-methylphenoxy)amino]propanal.
What is the SMILES notation for (2S)-2-[bis(2,6-ditert-butyl-4-methylphenoxy)amino]propanal?
The canonical SMILES for (2S)-2-[bis(2,6-ditert-butyl-4-methylphenoxy)amino]propanal is Cc1cc(C(C)(C)C)c(ON(Oc2c(C(C)(C)C)cc(C)cc2C(C)(C)C)[C@@H](C)C=O)c(C(C)(C)C)c1.
What is the InChIKey of (2S)-2-[bis(2,6-ditert-butyl-4-methylphenoxy)amino]propanal?
The InChIKey is LFCLHYLCTFYTQP-QHCPKHFHSA-N. The full InChI is InChI=1S/C33H51NO3/c1-21-16-24(30(4,5)6)28(25(17-21)31(7,8)9)36-34(23(3)20-35)37-29-26(32(10,11)12)18-22(2)19-27(29)33(13,14)15/h16-20,23H,1-15H3/t23-/m0/s1.
What are the key properties of (2S)-2-[bis(2,6-ditert-butyl-4-methylphenoxy)amino]propanal?
(2S)-2-[bis(2,6-ditert-butyl-4-methylphenoxy)amino]propanal has a molecular weight of 509.78 g/mol, XLogP of 8.67, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[bis(2,6-ditert-butyl-4-methylphenoxy)amino]propanal is sourced from PubChem (CID 173353632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).