C33H68O6Si3 — CID 173353777
1-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[dimethylsilyloxy-[3-(3,4,4-trimethylpentan-2-yl)oxiran-2-yl]methyl]oxan-2-yl]propan-2-one (PubChem CID 173353777) has the molecular formula C33H68O6Si3 and a molecular weight of 645.16 g/mol. Its IUPAC name is 1-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[dimethylsilyloxy-[3-(3,4,4-trimethylpentan-2-yl)oxiran-2-yl]methyl]oxan-2-yl]propan-2-one.
| Compound Name | 1-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[dimethylsilyloxy-[3-(3,4,4-trimethylpentan-2-yl)oxiran-2-yl]methyl]oxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 173353777 |
| Molecular Formula | C33H68O6Si3 |
| Molecular Weight | 645.16 g/mol |
| Exact Mass | 644.43 |
| IUPAC Name | 1-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[dimethylsilyloxy-[3-(3,4,4-trimethylpentan-2-yl)oxiran-2-yl]methyl]oxan-2-yl]propan-2-one |
| SMILES | CC(=O)CC1OCC(C(O[SiH](C)C)C2OC2C(C)C(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H68O6Si3/c1-21(34)19-25-29(39-42(17,18)33(10,11)12)28(38-41(15,16)32(7,8)9)24(20-35-25)27(37-40(13)14)30-26(36-30)22(2)23(3)31(4,5)6/h22-30,40H,19-20H2,1-18H3 |
| InChIKey | OLMLJZZKMTYTMT-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.16 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|