C22H21NO6 — CID 173353880
(Z)-4-hydroxy-2-[(2S,4S,6S)-2-hydroxy-4,15-dimethyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaen-4-yl]-4-oxobut-2-enoate (PubChem CID 173353880) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is (Z)-4-hydroxy-2-[(2S,4S,6S)-2-hydroxy-4,15-dimethyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaen-4-yl]-4-oxobut-2-enoate.
| Compound Name | (Z)-4-hydroxy-2-[(2S,4S,6S)-2-hydroxy-4,15-dimethyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaen-4-yl]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 173353880 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | (Z)-4-hydroxy-2-[(2S,4S,6S)-2-hydroxy-4,15-dimethyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaen-4-yl]-4-oxobut-2-enoate |
| SMILES | Cc1cccc2c1Oc1ccccc1[C@H]1C[N@+](C)(/C(=C\C(=O)O)C(=O)[O-])C[C@@]21O |
| InChI | InChI=1S/C22H21NO6/c1-13-6-5-8-15-20(13)29-18-9-4-3-7-14(18)16-11-23(2,12-22(15,16)28)17(21(26)27)10-19(24)25/h3-10,16,28H,11-12H2,1-2H3,(H-,24,25,26,27)/b17-10-/t16-,22-,23+/m1/s1 |
| InChIKey | VXHGWGAJCZIIIW-WKAIZMJESA-N |
| XLogP | 1.25 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|