C42H58BrP — CID 173354011
(5S,10S,13R,17R)-10,13-dimethyl-17-[(2R)-pentan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;triphenylphosphane;hydrobromide (PubChem CID 173354011) has the molecular formula C42H58BrP and a molecular weight of 673.80 g/mol. Its IUPAC name is (5S,10S,13R,17R)-10,13-dimethyl-17-[(2R)-pentan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;triphenylphosphane;hydrobromide.
| Compound Name | (5S,10S,13R,17R)-10,13-dimethyl-17-[(2R)-pentan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;triphenylphosphane;hydrobromide |
|---|---|
| PubChem CID | 173354011 |
| Molecular Formula | C42H58BrP |
| Molecular Weight | 673.80 g/mol |
| Exact Mass | 672.35 |
| IUPAC Name | (5S,10S,13R,17R)-10,13-dimethyl-17-[(2R)-pentan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;triphenylphosphane;hydrobromide |
| SMILES | Br.CCC[C@@H](C)[C@H]1CCC2C3CC[C@@H]4CCCC[C@]4(C)C3CC[C@@]21C.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H42.C18H15P.BrH/c1-5-8-17(2)20-12-13-21-19-11-10-18-9-6-7-15-23(18,3)22(19)14-16-24(20,21)4;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h17-22H,5-16H2,1-4H3;1-15H;1H/t17-,18+,19?,20-,21?,22?,23+,24-;;/m1../s1 |
| InChIKey | FAXXVPWYDGCZRC-PDMCJWFGSA-N |
| XLogP | 11.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.80 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|