C12H16FNO2 — CID 173354265
4,6-diethyl-7-fluoro-4a,8a-dihydro-1,4-benzoxazin-3-one (PubChem CID 173354265) has the molecular formula C12H16FNO2 and a molecular weight of 225.26 g/mol. Its IUPAC name is 4,6-diethyl-7-fluoro-4a,8a-dihydro-1,4-benzoxazin-3-one.
| Compound Name | 4,6-diethyl-7-fluoro-4a,8a-dihydro-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 173354265 |
| Molecular Formula | C12H16FNO2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 4,6-diethyl-7-fluoro-4a,8a-dihydro-1,4-benzoxazin-3-one |
| SMILES | CCC1=CC2C(C=C1F)OCC(=O)N2CC |
| InChI | InChI=1S/C12H16FNO2/c1-3-8-5-10-11(6-9(8)13)16-7-12(15)14(10)4-2/h5-6,10-11H,3-4,7H2,1-2H3 |
| InChIKey | SANFMQIKGNHSOY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |