About sodium;4-(9-aminononyl)benzenesulfonic acid;hydride
sodium;4-(9-aminononyl)benzenesulfonic acid;hydride (PubChem CID 173354445) has the molecular formula C15H26NNaO3S
and a molecular weight of 323.43 g/mol. Its IUPAC name is sodium;4-(9-aminononyl)benzenesulfonic acid;hydride.
Molecular Properties
| Compound Name | sodium;4-(9-aminononyl)benzenesulfonic acid;hydride |
| PubChem CID | 173354445 |
| Molecular Formula | C15H26NNaO3S |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | sodium;4-(9-aminononyl)benzenesulfonic acid;hydride |
| SMILES | NCCCCCCCCCc1ccc(S(=O)(=O)O)cc1.[H-].[Na+] |
| InChI | InChI=1S/C15H25NO3S.Na.H/c16-13-7-5-3-1-2-4-6-8-14-9-11-15(12-10-14)20(17,18)19;;/h9-12H,1-8,13,16H2,(H,17,18,19);;/q;+1;-1 |
| InChIKey | BCAXKGNFXYLFEA-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;4-(9-aminononyl)benzenesulfonic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;4-(9-aminononyl)benzenesulfonic acid;hydride?
The IUPAC name of sodium;4-(9-aminononyl)benzenesulfonic acid;hydride (CID 173354445) is sodium;4-(9-aminononyl)benzenesulfonic acid;hydride.
What is the SMILES notation for sodium;4-(9-aminononyl)benzenesulfonic acid;hydride?
The canonical SMILES for sodium;4-(9-aminononyl)benzenesulfonic acid;hydride is NCCCCCCCCCc1ccc(S(=O)(=O)O)cc1.[H-].[Na+].
What is the InChIKey of sodium;4-(9-aminononyl)benzenesulfonic acid;hydride?
The InChIKey is BCAXKGNFXYLFEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO3S.Na.H/c16-13-7-5-3-1-2-4-6-8-14-9-11-15(12-10-14)20(17,18)19;;/h9-12H,1-8,13,16H2,(H,17,18,19);;/q;+1;-1.
What are the key properties of sodium;4-(9-aminononyl)benzenesulfonic acid;hydride?
sodium;4-(9-aminononyl)benzenesulfonic acid;hydride has a molecular weight of 323.43 g/mol, XLogP of 0.28, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;4-(9-aminononyl)benzenesulfonic acid;hydride is sourced from PubChem (CID 173354445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).