C3H2F5LiO — CID 173355099
lithium;hydride;1,1,2,3,3-pentafluoroprop-2-en-1-ol (PubChem CID 173355099) has the molecular formula C3H2F5LiO and a molecular weight of 155.98 g/mol. Its IUPAC name is lithium;hydride;1,1,2,3,3-pentafluoroprop-2-en-1-ol.
| Compound Name | lithium;hydride;1,1,2,3,3-pentafluoroprop-2-en-1-ol |
|---|---|
| PubChem CID | 173355099 |
| Molecular Formula | C3H2F5LiO |
| Molecular Weight | 155.98 g/mol |
| Exact Mass | 156.02 |
| IUPAC Name | lithium;hydride;1,1,2,3,3-pentafluoroprop-2-en-1-ol |
| SMILES | OC(F)(F)C(F)=C(F)F.[H-].[Li+] |
| InChI | InChI=1S/C3HF5O.Li.H/c4-1(2(5)6)3(7,8)9;;/h9H;;/q;+1;-1 |
| InChIKey | OINDXHGYYAPTSM-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.98 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |