C34H27F6NO4S — CID 173355371
3-[3,3,4,4,5,5-hexafluoro-2-(5-methoxy-1,2-dimethylindol-3-yl)cyclopenten-1-yl]-6-[2-(4-methoxyphenyl)ethenyl]-2-methyl-1-benzothiophene 1,1-dioxide (PubChem CID 173355371) has the molecular formula C34H27F6NO4S and a molecular weight of 659.65 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-(5-methoxy-1,2-dimethylindol-3-yl)cyclopenten-1-yl]-6-[2-(4-methoxyphenyl)ethenyl]-2-methyl-1-benzothiophene 1,1-dioxide.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-(5-methoxy-1,2-dimethylindol-3-yl)cyclopenten-1-yl]-6-[2-(4-methoxyphenyl)ethenyl]-2-methyl-1-benzothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 173355371 |
| Molecular Formula | C34H27F6NO4S |
| Molecular Weight | 659.65 g/mol |
| Exact Mass | 659.16 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-(5-methoxy-1,2-dimethylindol-3-yl)cyclopenten-1-yl]-6-[2-(4-methoxyphenyl)ethenyl]-2-methyl-1-benzothiophene 1,1-dioxide |
| SMILES | COc1ccc(C=Cc2ccc3c(c2)S(=O)(=O)C(C)=C3C2=C(c3c(C)n(C)c4ccc(OC)cc34)C(F)(F)C(F)(F)C2(F)F)cc1 |
| InChI | InChI=1S/C34H27F6NO4S/c1-18-28(25-17-23(45-5)13-15-26(25)41(18)3)30-31(33(37,38)34(39,40)32(30,35)36)29-19(2)46(42,43)27-16-21(10-14-24(27)29)7-6-20-8-11-22(44-4)12-9-20/h6-17H,1-5H3 |
| InChIKey | MNWPNNMXEFOIQC-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.65 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|