About [4-(N-methoxy-C-methylcarbonimidoyl)phenyl]methyl 2-bromoacetate
[4-(N-methoxy-C-methylcarbonimidoyl)phenyl]methyl 2-bromoacetate (PubChem CID 173355646) has the molecular formula C12H14BrNO3
and a molecular weight of 300.15 g/mol. Its IUPAC name is [4-(N-methoxy-C-methylcarbonimidoyl)phenyl]methyl 2-bromoacetate.
Molecular Properties
| Compound Name | [4-(N-methoxy-C-methylcarbonimidoyl)phenyl]methyl 2-bromoacetate |
| PubChem CID | 173355646 |
| Molecular Formula | C12H14BrNO3 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | [4-(N-methoxy-C-methylcarbonimidoyl)phenyl]methyl 2-bromoacetate |
| SMILES | CON=C(C)c1ccc(COC(=O)CBr)cc1 |
| InChI | InChI=1S/C12H14BrNO3/c1-9(14-16-2)11-5-3-10(4-6-11)8-17-12(15)7-13/h3-6H,7-8H2,1-2H3 |
| InChIKey | TYFYYMXSUCAXTM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(N-methoxy-C-methylcarbonimidoyl)phenyl]methyl 2-bromoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(N-methoxy-C-methylcarbonimidoyl)phenyl]methyl 2-bromoacetate?
The IUPAC name of [4-(N-methoxy-C-methylcarbonimidoyl)phenyl]methyl 2-bromoacetate (CID 173355646) is [4-(N-methoxy-C-methylcarbonimidoyl)phenyl]methyl 2-bromoacetate.
What is the SMILES notation for [4-(N-methoxy-C-methylcarbonimidoyl)phenyl]methyl 2-bromoacetate?
The canonical SMILES for [4-(N-methoxy-C-methylcarbonimidoyl)phenyl]methyl 2-bromoacetate is CON=C(C)c1ccc(COC(=O)CBr)cc1.
What is the InChIKey of [4-(N-methoxy-C-methylcarbonimidoyl)phenyl]methyl 2-bromoacetate?
The InChIKey is TYFYYMXSUCAXTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrNO3/c1-9(14-16-2)11-5-3-10(4-6-11)8-17-12(15)7-13/h3-6H,7-8H2,1-2H3.
What are the key properties of [4-(N-methoxy-C-methylcarbonimidoyl)phenyl]methyl 2-bromoacetate?
[4-(N-methoxy-C-methylcarbonimidoyl)phenyl]methyl 2-bromoacetate has a molecular weight of 300.15 g/mol, XLogP of 2.50, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(N-methoxy-C-methylcarbonimidoyl)phenyl]methyl 2-bromoacetate is sourced from PubChem (CID 173355646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).