C21H18Cl2O4 — CID 173356195
9,9-bis(4-chlorophenyl)-5-hydroxy-3-oxonona-6,8-dienoic acid (PubChem CID 173356195) has the molecular formula C21H18Cl2O4 and a molecular weight of 405.28 g/mol. Its IUPAC name is 9,9-bis(4-chlorophenyl)-5-hydroxy-3-oxonona-6,8-dienoic acid.
| Compound Name | 9,9-bis(4-chlorophenyl)-5-hydroxy-3-oxonona-6,8-dienoic acid |
|---|---|
| PubChem CID | 173356195 |
| Molecular Formula | C21H18Cl2O4 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 9,9-bis(4-chlorophenyl)-5-hydroxy-3-oxonona-6,8-dienoic acid |
| SMILES | O=C(O)CC(=O)CC(O)C=CC=C(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18Cl2O4/c22-16-8-4-14(5-9-16)20(15-6-10-17(23)11-7-15)3-1-2-18(24)12-19(25)13-21(26)27/h1-11,18,24H,12-13H2,(H,26,27) |
| InChIKey | JSQBILZFRODBIY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|