About dimethoxyphosphoryl (E)-4-oxobut-2-enoate
dimethoxyphosphoryl (E)-4-oxobut-2-enoate (PubChem CID 173357059) has the molecular formula C6H9O6P
and a molecular weight of 208.11 g/mol. Its IUPAC name is dimethoxyphosphoryl (E)-4-oxobut-2-enoate.
Molecular Properties
| Compound Name | dimethoxyphosphoryl (E)-4-oxobut-2-enoate |
| PubChem CID | 173357059 |
| Molecular Formula | C6H9O6P |
| Molecular Weight | 208.11 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | dimethoxyphosphoryl (E)-4-oxobut-2-enoate |
| SMILES | COP(=O)(OC)OC(=O)/C=C/C=O |
| InChI | InChI=1S/C6H9O6P/c1-10-13(9,11-2)12-6(8)4-3-5-7/h3-5H,1-2H3/b4-3+ |
| InChIKey | GZCCKJHZUBLNQA-ONEGZZNKSA-N |
| XLogP | 0.69 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.11 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethoxyphosphoryl (E)-4-oxobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxyphosphoryl (E)-4-oxobut-2-enoate?
The IUPAC name of dimethoxyphosphoryl (E)-4-oxobut-2-enoate (CID 173357059) is dimethoxyphosphoryl (E)-4-oxobut-2-enoate.
What is the SMILES notation for dimethoxyphosphoryl (E)-4-oxobut-2-enoate?
The canonical SMILES for dimethoxyphosphoryl (E)-4-oxobut-2-enoate is COP(=O)(OC)OC(=O)/C=C/C=O.
What is the InChIKey of dimethoxyphosphoryl (E)-4-oxobut-2-enoate?
The InChIKey is GZCCKJHZUBLNQA-ONEGZZNKSA-N. The full InChI is InChI=1S/C6H9O6P/c1-10-13(9,11-2)12-6(8)4-3-5-7/h3-5H,1-2H3/b4-3+.
What are the key properties of dimethoxyphosphoryl (E)-4-oxobut-2-enoate?
dimethoxyphosphoryl (E)-4-oxobut-2-enoate has a molecular weight of 208.11 g/mol, XLogP of 0.69, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxyphosphoryl (E)-4-oxobut-2-enoate is sourced from PubChem (CID 173357059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).