C21H28O4 — CID 173357798
4-[3-[3-[2-(2-methoxyethoxy)ethoxy]phenyl]phenyl]butan-1-ol (PubChem CID 173357798) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is 4-[3-[3-[2-(2-methoxyethoxy)ethoxy]phenyl]phenyl]butan-1-ol.
| Compound Name | 4-[3-[3-[2-(2-methoxyethoxy)ethoxy]phenyl]phenyl]butan-1-ol |
|---|---|
| PubChem CID | 173357798 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 4-[3-[3-[2-(2-methoxyethoxy)ethoxy]phenyl]phenyl]butan-1-ol |
| SMILES | COCCOCCOc1cccc(-c2cccc(CCCCO)c2)c1 |
| InChI | InChI=1S/C21H28O4/c1-23-12-13-24-14-15-25-21-10-5-9-20(17-21)19-8-4-7-18(16-19)6-2-3-11-22/h4-5,7-10,16-17,22H,2-3,6,11-15H2,1H3 |
| InChIKey | SQWQOVIRQVWENB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|