About CID 173357830
CID 173357830 (PubChem CID 173357830) has the molecular formula C10H6Cl2KN2O3
and a molecular weight of 312.17 g/mol.
Molecular Properties
| Compound Name | CID 173357830 |
| PubChem CID | 173357830 |
| Molecular Formula | C10H6Cl2KN2O3 |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 310.94 |
| IUPAC Name | — |
| SMILES | O=C(NO)c1cc(=O)c2c(Cl)cc(Cl)cc2[nH]1.[K] |
| InChI | InChI=1S/C10H6Cl2N2O3.K/c11-4-1-5(12)9-6(2-4)13-7(3-8(9)15)10(16)14-17;/h1-3,17H,(H,13,15)(H,14,16); |
| InChIKey | UBBIZNOGOFBSHW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 173357830 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173357830?
The IUPAC name of CID 173357830 (CID 173357830) is not available.
What is the SMILES notation for CID 173357830?
The canonical SMILES for CID 173357830 is O=C(NO)c1cc(=O)c2c(Cl)cc(Cl)cc2[nH]1.[K].
What is the InChIKey of CID 173357830?
The InChIKey is UBBIZNOGOFBSHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Cl2N2O3.K/c11-4-1-5(12)9-6(2-4)13-7(3-8(9)15)10(16)14-17;/h1-3,17H,(H,13,15)(H,14,16);.
What are the key properties of CID 173357830?
CID 173357830 has a molecular weight of 312.17 g/mol, XLogP of 1.57, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173357830 is sourced from PubChem (CID 173357830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).