C15H24N3O4P — CID 173358268
ethyl 5-(2-diethoxyphosphanylethenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine-2-carboxylate (PubChem CID 173358268) has the molecular formula C15H24N3O4P and a molecular weight of 341.35 g/mol. Its IUPAC name is ethyl 5-(2-diethoxyphosphanylethenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine-2-carboxylate.
| Compound Name | ethyl 5-(2-diethoxyphosphanylethenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 173358268 |
| Molecular Formula | C15H24N3O4P |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | ethyl 5-(2-diethoxyphosphanylethenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine-2-carboxylate |
| SMILES | CCOC(=O)c1cn2c(n1)NCCC2C=CP(OCC)OCC |
| InChI | InChI=1S/C15H24N3O4P/c1-4-20-14(19)13-11-18-12(7-9-16-15(18)17-13)8-10-23(21-5-2)22-6-3/h8,10-12H,4-7,9H2,1-3H3,(H,16,17) |
| InChIKey | FLHOYXMJABXSQR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|