C27H20Br2CuN2O4S — CID 173358818
copper;bis(4-bromobenzoate);1,3-diphenylthiourea (PubChem CID 173358818) has the molecular formula C27H20Br2CuN2O4S and a molecular weight of 691.89 g/mol. Its IUPAC name is copper;bis(4-bromobenzoate);1,3-diphenylthiourea.
| Compound Name | copper;bis(4-bromobenzoate);1,3-diphenylthiourea |
|---|---|
| PubChem CID | 173358818 |
| Molecular Formula | C27H20Br2CuN2O4S |
| Molecular Weight | 691.89 g/mol |
| Exact Mass | 688.88 |
| IUPAC Name | copper;bis(4-bromobenzoate);1,3-diphenylthiourea |
| SMILES | O=C([O-])c1ccc(Br)cc1.O=C([O-])c1ccc(Br)cc1.S=C(Nc1ccccc1)Nc1ccccc1.[Cu+2] |
| InChI | InChI=1S/C13H12N2S.2C7H5BrO2.Cu/c16-13(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12;2*8-6-3-1-5(2-4-6)7(9)10;/h1-10H,(H2,14,15,16);2*1-4H,(H,9,10);/q;;;+2/p-2 |
| InChIKey | YXRSLVDCLHVJCV-UHFFFAOYSA-L |
| XLogP | 5.12 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.89 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|