About cesium;hydride;selenic acid
cesium;hydride;selenic acid (PubChem CID 173359749) has the molecular formula H3CsO4Se
and a molecular weight of 278.89 g/mol. Its IUPAC name is cesium;hydride;selenic acid.
Molecular Properties
| Compound Name | cesium;hydride;selenic acid |
| PubChem CID | 173359749 |
| Molecular Formula | H3CsO4Se |
| Molecular Weight | 278.89 g/mol |
| Exact Mass | 279.83 |
| IUPAC Name | cesium;hydride;selenic acid |
| SMILES | O=[Se](=O)(O)O.[Cs+].[H-] |
| InChI | InChI=1S/Cs.H2O4Se.H/c;1-5(2,3)4;/h;(H2,1,2,3,4);/q+1;;-1 |
| InChIKey | YABFHOZETAKHHB-UHFFFAOYSA-N |
| XLogP | -4.62 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.89 |
| LogP ≤ 5 | -4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cesium;hydride;selenic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium;hydride;selenic acid?
The IUPAC name of cesium;hydride;selenic acid (CID 173359749) is cesium;hydride;selenic acid.
What is the SMILES notation for cesium;hydride;selenic acid?
The canonical SMILES for cesium;hydride;selenic acid is O=[Se](=O)(O)O.[Cs+].[H-].
What is the InChIKey of cesium;hydride;selenic acid?
The InChIKey is YABFHOZETAKHHB-UHFFFAOYSA-N. The full InChI is InChI=1S/Cs.H2O4Se.H/c;1-5(2,3)4;/h;(H2,1,2,3,4);/q+1;;-1.
What are the key properties of cesium;hydride;selenic acid?
cesium;hydride;selenic acid has a molecular weight of 278.89 g/mol, XLogP of -4.62, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cesium;hydride;selenic acid is sourced from PubChem (CID 173359749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).