C35H54O7Si — CID 173359822
(2R)-1-[5-[tert-butyl(dimethyl)silyl]oxy-3-(oxan-2-yloxy)-2-[3-(oxan-2-yloxy)-4-phenoxybut-1-enyl]cyclopentyl]but-3-yn-2-ol (PubChem CID 173359822) has the molecular formula C35H54O7Si and a molecular weight of 614.90 g/mol. Its IUPAC name is (2R)-1-[5-[tert-butyl(dimethyl)silyl]oxy-3-(oxan-2-yloxy)-2-[3-(oxan-2-yloxy)-4-phenoxybut-1-enyl]cyclopentyl]but-3-yn-2-ol.
| Compound Name | (2R)-1-[5-[tert-butyl(dimethyl)silyl]oxy-3-(oxan-2-yloxy)-2-[3-(oxan-2-yloxy)-4-phenoxybut-1-enyl]cyclopentyl]but-3-yn-2-ol |
|---|---|
| PubChem CID | 173359822 |
| Molecular Formula | C35H54O7Si |
| Molecular Weight | 614.90 g/mol |
| Exact Mass | 614.36 |
| IUPAC Name | (2R)-1-[5-[tert-butyl(dimethyl)silyl]oxy-3-(oxan-2-yloxy)-2-[3-(oxan-2-yloxy)-4-phenoxybut-1-enyl]cyclopentyl]but-3-yn-2-ol |
| SMILES | C#C[C@H](O)CC1C(O[Si](C)(C)C(C)(C)C)CC(OC2CCCCO2)C1C=CC(COc1ccccc1)OC1CCCCO1 |
| InChI | InChI=1S/C35H54O7Si/c1-7-26(36)23-30-29(20-19-28(40-33-17-11-13-21-37-33)25-39-27-15-9-8-10-16-27)31(41-34-18-12-14-22-38-34)24-32(30)42-43(5,6)35(2,3)4/h1,8-10,15-16,19-20,26,28-34,36H,11-14,17-18,21-25H2,2-6H3/t26-,28?,29?,30?,31?,32?,33?,34?/m0/s1 |
| InChIKey | WZXOUACVADIKEZ-MIEGGLMKSA-N |
| XLogP | 6.86 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.90 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|