About potassium;hydride;(2-methylprop-2-enoylamino)methanesulfonic acid
potassium;hydride;(2-methylprop-2-enoylamino)methanesulfonic acid (PubChem CID 173360160) has the molecular formula C5H10KNO4S
and a molecular weight of 219.30 g/mol. Its IUPAC name is potassium;hydride;(2-methylprop-2-enoylamino)methanesulfonic acid.
Molecular Properties
| Compound Name | potassium;hydride;(2-methylprop-2-enoylamino)methanesulfonic acid |
| PubChem CID | 173360160 |
| Molecular Formula | C5H10KNO4S |
| Molecular Weight | 219.30 g/mol |
| Exact Mass | 219.00 |
| IUPAC Name | potassium;hydride;(2-methylprop-2-enoylamino)methanesulfonic acid |
| SMILES | C=C(C)C(=O)NCS(=O)(=O)O.[H-].[K+] |
| InChI | InChI=1S/C5H9NO4S.K.H/c1-4(2)5(7)6-3-11(8,9)10;;/h1,3H2,2H3,(H,6,7)(H,8,9,10);;/q;+1;-1 |
| InChIKey | SEJYOYJHDVPSRV-UHFFFAOYSA-N |
| XLogP | -3.36 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.30 |
| LogP ≤ 5 | -3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;(2-methylprop-2-enoylamino)methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;(2-methylprop-2-enoylamino)methanesulfonic acid?
The IUPAC name of potassium;hydride;(2-methylprop-2-enoylamino)methanesulfonic acid (CID 173360160) is potassium;hydride;(2-methylprop-2-enoylamino)methanesulfonic acid.
What is the SMILES notation for potassium;hydride;(2-methylprop-2-enoylamino)methanesulfonic acid?
The canonical SMILES for potassium;hydride;(2-methylprop-2-enoylamino)methanesulfonic acid is C=C(C)C(=O)NCS(=O)(=O)O.[H-].[K+].
What is the InChIKey of potassium;hydride;(2-methylprop-2-enoylamino)methanesulfonic acid?
The InChIKey is SEJYOYJHDVPSRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO4S.K.H/c1-4(2)5(7)6-3-11(8,9)10;;/h1,3H2,2H3,(H,6,7)(H,8,9,10);;/q;+1;-1.
What are the key properties of potassium;hydride;(2-methylprop-2-enoylamino)methanesulfonic acid?
potassium;hydride;(2-methylprop-2-enoylamino)methanesulfonic acid has a molecular weight of 219.30 g/mol, XLogP of -3.36, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;(2-methylprop-2-enoylamino)methanesulfonic acid is sourced from PubChem (CID 173360160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).