C9H21NOSi — CID 173360190
N,2-diethyl-2-methyl-N-silylbutanamide (PubChem CID 173360190) has the molecular formula C9H21NOSi and a molecular weight of 187.36 g/mol. Its IUPAC name is N,2-diethyl-2-methyl-N-silylbutanamide.
| Compound Name | N,2-diethyl-2-methyl-N-silylbutanamide |
|---|---|
| PubChem CID | 173360190 |
| Molecular Formula | C9H21NOSi |
| Molecular Weight | 187.36 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | N,2-diethyl-2-methyl-N-silylbutanamide |
| SMILES | CCN([SiH3])C(=O)C(C)(CC)CC |
| InChI | InChI=1S/C9H21NOSi/c1-5-9(4,6-2)8(11)10(12)7-3/h5-7H2,1-4,12H3 |
| InChIKey | PSIZVTOPSYPPDZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|