About N'-[(E)-N-ethyl-N'-nitrocarbamimidoyl]-N,N-dimethylmethanimidamide
N'-[(E)-N-ethyl-N'-nitrocarbamimidoyl]-N,N-dimethylmethanimidamide (PubChem CID 173360206) has the molecular formula C6H13N5O2
and a molecular weight of 187.20 g/mol. Its IUPAC name is N'-[(E)-N-ethyl-N'-nitrocarbamimidoyl]-N,N-dimethylmethanimidamide.
Molecular Properties
| Compound Name | N'-[(E)-N-ethyl-N'-nitrocarbamimidoyl]-N,N-dimethylmethanimidamide |
| PubChem CID | 173360206 |
| Molecular Formula | C6H13N5O2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | N'-[(E)-N-ethyl-N'-nitrocarbamimidoyl]-N,N-dimethylmethanimidamide |
| SMILES | CCN/C(N=CN(C)C)=N\[N+](=O)[O-] |
| InChI | InChI=1S/C6H13N5O2/c1-4-7-6(9-11(12)13)8-5-10(2)3/h5H,4H2,1-3H3,(H,7,9) |
| InChIKey | FZLOYNYBBCYGDS-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[(E)-N-ethyl-N'-nitrocarbamimidoyl]-N,N-dimethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(E)-N-ethyl-N'-nitrocarbamimidoyl]-N,N-dimethylmethanimidamide?
The IUPAC name of N'-[(E)-N-ethyl-N'-nitrocarbamimidoyl]-N,N-dimethylmethanimidamide (CID 173360206) is N'-[(E)-N-ethyl-N'-nitrocarbamimidoyl]-N,N-dimethylmethanimidamide.
What is the SMILES notation for N'-[(E)-N-ethyl-N'-nitrocarbamimidoyl]-N,N-dimethylmethanimidamide?
The canonical SMILES for N'-[(E)-N-ethyl-N'-nitrocarbamimidoyl]-N,N-dimethylmethanimidamide is CCN/C(N=CN(C)C)=N\[N+](=O)[O-].
What is the InChIKey of N'-[(E)-N-ethyl-N'-nitrocarbamimidoyl]-N,N-dimethylmethanimidamide?
The InChIKey is FZLOYNYBBCYGDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N5O2/c1-4-7-6(9-11(12)13)8-5-10(2)3/h5H,4H2,1-3H3,(H,7,9).
What are the key properties of N'-[(E)-N-ethyl-N'-nitrocarbamimidoyl]-N,N-dimethylmethanimidamide?
N'-[(E)-N-ethyl-N'-nitrocarbamimidoyl]-N,N-dimethylmethanimidamide has a molecular weight of 187.20 g/mol, XLogP of -0.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(E)-N-ethyl-N'-nitrocarbamimidoyl]-N,N-dimethylmethanimidamide is sourced from PubChem (CID 173360206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).