C33H62O2Si2 — CID 173360708
[(2R,3S,3aS,6aS)-3-[(E,4S)-4-tert-butyl-3-methyl-9-silyloxynon-2-en-2-yl]-5-pent-4-enyl-1,2,3,3a,4,6a-hexahydropentalen-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 173360708) has the molecular formula C33H62O2Si2 and a molecular weight of 547.03 g/mol. Its IUPAC name is [(2R,3S,3aS,6aS)-3-[(E,4S)-4-tert-butyl-3-methyl-9-silyloxynon-2-en-2-yl]-5-pent-4-enyl-1,2,3,3a,4,6a-hexahydropentalen-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3S,3aS,6aS)-3-[(E,4S)-4-tert-butyl-3-methyl-9-silyloxynon-2-en-2-yl]-5-pent-4-enyl-1,2,3,3a,4,6a-hexahydropentalen-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 173360708 |
| Molecular Formula | C33H62O2Si2 |
| Molecular Weight | 547.03 g/mol |
| Exact Mass | 546.43 |
| IUPAC Name | [(2R,3S,3aS,6aS)-3-[(E,4S)-4-tert-butyl-3-methyl-9-silyloxynon-2-en-2-yl]-5-pent-4-enyl-1,2,3,3a,4,6a-hexahydropentalen-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CCCCC1=C[C@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](/C(C)=C(\C)[C@@H](CCCCCO[SiH3])C(C)(C)C)[C@H]2C1 |
| InChI | InChI=1S/C33H62O2Si2/c1-12-13-15-18-26-21-27-23-30(35-37(10,11)33(7,8)9)31(28(27)22-26)25(3)24(2)29(32(4,5)6)19-16-14-17-20-34-36/h12,21,27-31H,1,13-20,22-23H2,2-11,36H3/b25-24+/t27-,28-,29+,30+,31+/m0/s1 |
| InChIKey | FXTNDRACLORGMH-OZLDANIZSA-N |
| XLogP | 9.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.03 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|