About 6-amino-5-methyl-6-oxohex-4-ene-3-sulfonic acid;3-(hydroxymethyl)-2-(phosphanylmethyl)pentane-1,5-diol
6-amino-5-methyl-6-oxohex-4-ene-3-sulfonic acid;3-(hydroxymethyl)-2-(phosphanylmethyl)pentane-1,5-diol (PubChem CID 173360954) has the molecular formula C14H30NO7PS
and a molecular weight of 387.44 g/mol. Its IUPAC name is 6-amino-5-methyl-6-oxohex-4-ene-3-sulfonic acid;3-(hydroxymethyl)-2-(phosphanylmethyl)pentane-1,5-diol.
Molecular Properties
| Compound Name | 6-amino-5-methyl-6-oxohex-4-ene-3-sulfonic acid;3-(hydroxymethyl)-2-(phosphanylmethyl)pentane-1,5-diol |
| PubChem CID | 173360954 |
| Molecular Formula | C14H30NO7PS |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 6-amino-5-methyl-6-oxohex-4-ene-3-sulfonic acid;3-(hydroxymethyl)-2-(phosphanylmethyl)pentane-1,5-diol |
| SMILES | CCC(C=C(C)C(N)=O)S(=O)(=O)O.OCCC(CO)C(CO)CP |
| InChI | InChI=1S/C7H13NO4S.C7H17O3P/c1-3-6(13(10,11)12)4-5(2)7(8)9;8-2-1-6(3-9)7(4-10)5-11/h4,6H,3H2,1-2H3,(H2,8,9)(H,10,11,12);6-10H,1-5,11H2 |
| InChIKey | SHKNRRFEDWBUOM-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-5-methyl-6-oxohex-4-ene-3-sulfonic acid;3-(hydroxymethyl)-2-(phosphanylmethyl)pentane-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-methyl-6-oxohex-4-ene-3-sulfonic acid;3-(hydroxymethyl)-2-(phosphanylmethyl)pentane-1,5-diol?
The IUPAC name of 6-amino-5-methyl-6-oxohex-4-ene-3-sulfonic acid;3-(hydroxymethyl)-2-(phosphanylmethyl)pentane-1,5-diol (CID 173360954) is 6-amino-5-methyl-6-oxohex-4-ene-3-sulfonic acid;3-(hydroxymethyl)-2-(phosphanylmethyl)pentane-1,5-diol.
What is the SMILES notation for 6-amino-5-methyl-6-oxohex-4-ene-3-sulfonic acid;3-(hydroxymethyl)-2-(phosphanylmethyl)pentane-1,5-diol?
The canonical SMILES for 6-amino-5-methyl-6-oxohex-4-ene-3-sulfonic acid;3-(hydroxymethyl)-2-(phosphanylmethyl)pentane-1,5-diol is CCC(C=C(C)C(N)=O)S(=O)(=O)O.OCCC(CO)C(CO)CP.
What is the InChIKey of 6-amino-5-methyl-6-oxohex-4-ene-3-sulfonic acid;3-(hydroxymethyl)-2-(phosphanylmethyl)pentane-1,5-diol?
The InChIKey is SHKNRRFEDWBUOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO4S.C7H17O3P/c1-3-6(13(10,11)12)4-5(2)7(8)9;8-2-1-6(3-9)7(4-10)5-11/h4,6H,3H2,1-2H3,(H2,8,9)(H,10,11,12);6-10H,1-5,11H2.
What are the key properties of 6-amino-5-methyl-6-oxohex-4-ene-3-sulfonic acid;3-(hydroxymethyl)-2-(phosphanylmethyl)pentane-1,5-diol?
6-amino-5-methyl-6-oxohex-4-ene-3-sulfonic acid;3-(hydroxymethyl)-2-(phosphanylmethyl)pentane-1,5-diol has a molecular weight of 387.44 g/mol, XLogP of -0.45, 10 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-methyl-6-oxohex-4-ene-3-sulfonic acid;3-(hydroxymethyl)-2-(phosphanylmethyl)pentane-1,5-diol is sourced from PubChem (CID 173360954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).