About 5-[(E)-4-(3,4-dichlorophenyl)but-3-en-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one
5-[(E)-4-(3,4-dichlorophenyl)but-3-en-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 173361108) has the molecular formula C13H9Cl2NOS2
and a molecular weight of 330.26 g/mol. Its IUPAC name is 5-[(E)-4-(3,4-dichlorophenyl)but-3-en-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 5-[(E)-4-(3,4-dichlorophenyl)but-3-en-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| PubChem CID | 173361108 |
| Molecular Formula | C13H9Cl2NOS2 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 328.95 |
| IUPAC Name | 5-[(E)-4-(3,4-dichlorophenyl)but-3-en-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC(/C=C/c1ccc(Cl)c(Cl)c1)=C1SC(=S)NC1=O |
| InChI | InChI=1S/C13H9Cl2NOS2/c1-7(11-12(17)16-13(18)19-11)2-3-8-4-5-9(14)10(15)6-8/h2-6H,1H3,(H,16,17,18)/b3-2+,11-7? |
| InChIKey | IBRBMVBTVMWRRJ-GHCHQBRISA-N |
| XLogP | 4.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-[(E)-4-(3,4-dichlorophenyl)but-3-en-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-4-(3,4-dichlorophenyl)but-3-en-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one?
The IUPAC name of 5-[(E)-4-(3,4-dichlorophenyl)but-3-en-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (CID 173361108) is 5-[(E)-4-(3,4-dichlorophenyl)but-3-en-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
What is the SMILES notation for 5-[(E)-4-(3,4-dichlorophenyl)but-3-en-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one?
The canonical SMILES for 5-[(E)-4-(3,4-dichlorophenyl)but-3-en-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one is CC(/C=C/c1ccc(Cl)c(Cl)c1)=C1SC(=S)NC1=O.
What is the InChIKey of 5-[(E)-4-(3,4-dichlorophenyl)but-3-en-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one?
The InChIKey is IBRBMVBTVMWRRJ-GHCHQBRISA-N. The full InChI is InChI=1S/C13H9Cl2NOS2/c1-7(11-12(17)16-13(18)19-11)2-3-8-4-5-9(14)10(15)6-8/h2-6H,1H3,(H,16,17,18)/b3-2+,11-7?.
What are the key properties of 5-[(E)-4-(3,4-dichlorophenyl)but-3-en-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one?
5-[(E)-4-(3,4-dichlorophenyl)but-3-en-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one has a molecular weight of 330.26 g/mol, XLogP of 4.43, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-4-(3,4-dichlorophenyl)but-3-en-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one is sourced from PubChem (CID 173361108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).