C11H12O3 — CID 173361220
3,4,5,8-tetrahydro-1H-isochromene-5,8-dicarbaldehyde (PubChem CID 173361220) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is 3,4,5,8-tetrahydro-1H-isochromene-5,8-dicarbaldehyde.
| Compound Name | 3,4,5,8-tetrahydro-1H-isochromene-5,8-dicarbaldehyde |
|---|---|
| PubChem CID | 173361220 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 3,4,5,8-tetrahydro-1H-isochromene-5,8-dicarbaldehyde |
| SMILES | O=CC1C=CC(C=O)C2=C1CCOC2 |
| InChI | InChI=1S/C11H12O3/c12-5-8-1-2-9(6-13)11-7-14-4-3-10(8)11/h1-2,5-6,8-9H,3-4,7H2 |
| InChIKey | GJYLGFHAGVXVHH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|