C5H9N3O — CID 173361238
4-methoxy-2-methyl-1,4-dihydro-1,3,5-triazine (PubChem CID 173361238) has the molecular formula C5H9N3O and a molecular weight of 127.15 g/mol. Its IUPAC name is 4-methoxy-2-methyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 4-methoxy-2-methyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 173361238 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | 4-methoxy-2-methyl-1,4-dihydro-1,3,5-triazine |
| SMILES | COC1N=CNC(C)=N1 |
| InChI | InChI=1S/C5H9N3O/c1-4-6-3-7-5(8-4)9-2/h3,5H,1-2H3,(H,6,7,8) |
| InChIKey | VKMXXSFDGLGPGU-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |