C21H30N6O3 — CID 173361303
(2S)-2-[(2-aminoacetyl)amino]-N-[(2S)-6-amino-1-(2-methylphenyl)-1-oxohexan-2-yl]-3-(1H-imidazol-5-yl)propanamide (PubChem CID 173361303) has the molecular formula C21H30N6O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is (2S)-2-[(2-aminoacetyl)amino]-N-[(2S)-6-amino-1-(2-methylphenyl)-1-oxohexan-2-yl]-3-(1H-imidazol-5-yl)propanamide.
| Compound Name | (2S)-2-[(2-aminoacetyl)amino]-N-[(2S)-6-amino-1-(2-methylphenyl)-1-oxohexan-2-yl]-3-(1H-imidazol-5-yl)propanamide |
|---|---|
| PubChem CID | 173361303 |
| Molecular Formula | C21H30N6O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | (2S)-2-[(2-aminoacetyl)amino]-N-[(2S)-6-amino-1-(2-methylphenyl)-1-oxohexan-2-yl]-3-(1H-imidazol-5-yl)propanamide |
| SMILES | Cc1ccccc1C(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CN |
| InChI | InChI=1S/C21H30N6O3/c1-14-6-2-3-7-16(14)20(29)17(8-4-5-9-22)27-21(30)18(26-19(28)11-23)10-15-12-24-13-25-15/h2-3,6-7,12-13,17-18H,4-5,8-11,22-23H2,1H3,(H,24,25)(H,26,28)(H,27,30)/t17-,18-/m0/s1 |
| InChIKey | ZLYUPFAHTABMJJ-ROUUACIJSA-N |
| XLogP | 0.20 |
| TPSA | 155.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|